871329-84-9 Usage
General Description
(3-carboxy-5-fluoro)benzeneboronic acid is a chemical compound with the molecular formula C7H6BFO4. It is a boronic acid derivative that features a carboxylic acid group and a fluorine atom attached to a benzene ring. (3-CARBOXY-5-FLUORO)BENZENEBORONIC ACID is commonly used in the field of organic chemistry as a reagent for the synthesis of various pharmaceuticals and agrochemicals. It is also used in the development of fluorescent probes for biological imaging. The presence of the boronic acid group allows it to form reversible covalent bonds with diols and other nucleophiles, making it a valuable tool in the study of carbohydrate recognition and glycosylation reactions. Additionally, its fluorine substituent can impart unique properties to the molecules it is attached to, making it useful for medicinal chemistry and drug discovery applications.
Check Digit Verification of cas no
The CAS Registry Mumber 871329-84-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,2 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 871329-84:
(8*8)+(7*7)+(6*1)+(5*3)+(4*2)+(3*9)+(2*8)+(1*4)=189
189 % 10 = 9
So 871329-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BFO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,12-13H,(H,10,11)
