871329-85-0 Usage
Uses
Used in Pharmaceutical Synthesis:
(3-FLUORO-5-ETHOXYCARBONYL)BENZENEBORONIC ACID is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs with improved efficacy and selectivity. Its unique structure allows for the creation of diverse molecular entities with potential therapeutic applications.
Used in Agrochemical Synthesis:
In the agrochemical industry, (3-FLUORO-5-ETHOXYCARBONYL)BENZENEBORONIC ACID is employed as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
(3-FLUORO-5-ETHOXYCARBONYL)BENZENEBORONIC ACID is used as a reagent in Suzuki-Miyaura cross-coupling reactions, a widely employed method for forming carbon-carbon bonds. This reaction is crucial in the synthesis of complex organic molecules, including those with potential applications in materials science and drug discovery.
Used in Drug Discovery:
Due to its unique structure and reactivity, (3-FLUORO-5-ETHOXYCARBONYL)BENZENEBORONIC ACID has potential applications in drug discovery, where it can be used to design and synthesize novel compounds with therapeutic potential. Its versatility in chemical reactions allows for the exploration of various chemical spaces, leading to the identification of new drug candidates.
Used in Material Science:
(3-FLUORO-5-ETHOXYCARBONYL)BENZENEBORONIC ACID also finds applications in material science, where it can be used to develop new materials with specific properties. Its incorporation into the synthesis of polymers, coatings, and other materials can lead to the creation of innovative products with improved performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 871329-85-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,2 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871329-85:
(8*8)+(7*7)+(6*1)+(5*3)+(4*2)+(3*9)+(2*8)+(1*5)=190
190 % 10 = 0
So 871329-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BFO4/c1-2-15-9(12)6-3-7(10(13)14)5-8(11)4-6/h3-5,13-14H,2H2,1H3
