871332-74-0 Usage
Uses
Used in Organic Synthesis:
4-Chloro-3-(Isopropylcarbamoyl)Phenylboronic Acid is used as a key intermediate in organic synthesis for the preparation of various organic compounds. Its boronic acid group allows it to participate in palladium-catalyzed cross-coupling reactions, such as the Suzuki coupling, which is widely used for the formation of carbon-carbon bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Chloro-3-(Isopropylcarbamoyl)Phenylboronic Acid is used as a building block for the synthesis of various drug molecules. Its unique structure and reactivity enable the development of new pharmaceutical compounds with improved therapeutic properties.
Used in Agrochemicals:
4-Chloro-3-(Isopropylcarbamoyl)Phenylboronic Acid is utilized in the agrochemical industry for the synthesis of various agrochemical products, such as pesticides and herbicides. Its versatility in chemical reactions allows for the development of new and effective agrochemicals to protect crops and enhance agricultural productivity.
Used in Materials Science:
In the field of materials science, 4-Chloro-3-(Isopropylcarbamoyl)Phenylboronic Acid is employed for the synthesis of advanced materials with specific properties. Its incorporation into materials can lead to the development of new materials with improved characteristics, such as enhanced stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-74-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 871332-74:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*7)+(1*4)=170
170 % 10 = 0
So 871332-74-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BClNO3/c1-6(2)13-10(14)8-5-7(11(15)16)3-4-9(8)12/h3-6,15-16H,1-2H3,(H,13,14)
