871332-79-5 Usage
Uses
Used in Pharmaceutical Synthesis:
3-(Ethylcarbamoyl)-5-nitrophenylboronic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique functional groups enable the formation of carbon-carbon bonds through Suzuki-Miyaura coupling reactions, facilitating the creation of complex molecular structures with potential therapeutic applications.
Used in Organic Synthesis:
In the realm of organic synthesis, 3-(Ethylcarbamoyl)-5-nitrophenylboronic acid serves as a valuable reagent for the functionalization of aromatic compounds. Its boronic acid group allows for the formation of new carbon-carbon bonds, while the nitro and ethylcarbamoyl groups provide additional sites for further chemical modifications, enhancing the compound's versatility in organic chemistry.
Used in Medicinal Chemistry:
3-(Ethylcarbamoyl)-5-nitrophenylboronic acid is employed in medicinal chemistry for the development of novel therapeutic agents. Its unique structural features make it a promising candidate for the design and synthesis of bioactive molecules with potential applications in the treatment of various diseases and medical conditions.
Used in Chemical Research and Development:
In the field of chemical research and development, 3-(Ethylcarbamoyl)-5-nitrophenylboronic acid is utilized for exploring new synthetic pathways and methodologies. Its presence in various chemical reactions provides insights into the reactivity and selectivity of different functional groups, contributing to the advancement of chemical science and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871332-79:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*7)+(1*9)=175
175 % 10 = 5
So 871332-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BN2O5/c1-2-11-9(13)6-3-7(10(14)15)5-8(4-6)12(16)17/h3-5,14-15H,2H2,1H3,(H,11,13)
