871332-83-1 Usage
Uses
Used in Organic Synthesis:
3-(ISOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is used as a reagent for the formation of carbon-carbon and carbon-nitrogen bonds in organic synthesis. It plays a crucial role in Suzuki coupling reactions and other cross-coupling reactions, facilitating the formation of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(ISOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is studied for its potential medicinal properties. It has shown anti-cancer and anti-inflammatory activities, making it a promising candidate for the development of new therapeutic agents.
Used in Chemical Research:
3-(ISOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is also utilized in chemical research to explore its unique properties and potential applications. Its versatility and reactivity in various chemical reactions make it an essential tool for researchers in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-83-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 871332-83:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*3)=171
171 % 10 = 1
So 871332-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BN2O5/c1-6(2)12-10(14)7-3-8(11(15)16)5-9(4-7)13(17)18/h3-6,15-16H,1-2H3,(H,12,14)
