871332-84-2 Usage
Uses
Used in Organic Synthesis:
3-[Methoxy(methyl)carbamoyl)-5-nitrophenylboronic acid is used as a reagent in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique structure allows it to participate in various chemical reactions, facilitating the synthesis of complex organic molecules.
Used in the Suzuki-Miyaura Coupling Reaction:
In the field of organic chemistry, 3-[Methoxy(methyl)carbamoyl]-5-nitrophenylboronic acid is utilized in the Suzuki-Miyaura coupling reaction, which is a significant method for the formation of biaryl compounds. This reaction plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials, making the compound an essential component in these processes.
Used in Pharmaceutical Development:
3-[Methoxy(methyl)carbamoyl]-5-nitrophenylboronic acid is employed in the development of pharmaceuticals due to its diverse chemical reactivity. Its ability to form carbon-carbon and carbon-heteroatom bonds makes it a valuable building block for the synthesis of various drug molecules, contributing to the discovery of new therapeutic agents.
Used in Agrochemical Development:
In the agrochemical industry, 3-[Methoxy(methyl)carbamoyl]-5-nitrophenylboronic acid is used for the development of new agrochemicals. Its reactivity and ability to form different types of chemical bonds make it a valuable component in the synthesis of pesticides, herbicides, and other agrochemical products.
Used in Material Science:
3-[Methoxy(methyl)carbamoyl]-5-nitrophenylboronic acid is also utilized in material science for the development of new materials with unique properties. Its chemical reactivity allows it to be incorporated into the synthesis of advanced materials, such as polymers, coatings, and composites, enhancing their performance and expanding their applications.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-84-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 871332-84:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*4)=172
172 % 10 = 2
So 871332-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BN2O6/c1-11(18-2)9(13)6-3-7(10(14)15)5-8(4-6)12(16)17/h3-5,14-15H,1-2H3
