871332-86-4 Usage
Uses
Used in Organic Synthesis:
3-(CYCLOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is used as a building block for the construction of various pharmaceuticals and agrochemicals. Its unique structure allows for the synthesis of complex organic molecules with potential therapeutic and pesticidal properties.
Used in Cross-Coupling Reactions:
In the field of organic chemistry, 3-(CYCLOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID serves as a reagent in cross-coupling reactions, facilitating the formation of carbon-carbon bonds. This capability is crucial for the synthesis of advanced organic compounds and materials.
Used in Material Science and Chemical Process Development:
3-(CYCLOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is utilized in the development of new materials and chemical processes. Its properties can contribute to the creation of innovative materials with improved performance characteristics for various applications.
Used in Biological Research and Medicinal Chemistry:
3-(CYCLOPROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID has been studied for its potential biological activities and medicinal properties. Its unique structure may offer insights into new therapeutic approaches and the development of novel drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-86-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 871332-86:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*6)=174
174 % 10 = 4
So 871332-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BN2O5/c14-10(12-8-1-2-8)6-3-7(11(15)16)5-9(4-6)13(17)18/h3-5,8,15-16H,1-2H2,(H,12,14)
