871332-88-6 Usage
General Description
3-(Propylcarbamoyl)-5-nitrophenylboronic acid is a chemical compound with the molecular formula C11H15BN2O6. It is a boronic acid derivative that contains a propylcarbamoyl group and a nitrophenyl group. 3-(PROPYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID is commonly used in organic synthesis and medicinal chemistry as a building block for the synthesis of various biologically active molecules. Its boronic acid functionality makes it a useful reagent for Suzuki-Miyaura cross-coupling reactions, which are widely used in the synthesis of pharmaceuticals and agrochemicals. The nitro group also imparts unique reactivity and properties to the molecule, making it a versatile and valuable tool for chemical and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-88-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 871332-88:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*8)=176
176 % 10 = 6
So 871332-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BN2O5/c1-2-3-12-10(14)7-4-8(11(15)16)6-9(5-7)13(17)18/h4-6,15-16H,2-3H2,1H3,(H,12,14)
