871332-89-7 Usage
Uses
Used in Organic Synthesis:
3-(N-Butylcarbamoyl)-5-nitrophenylboronic acid is used as a reagent in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique structure allows for versatile reactions and the creation of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(N-Butylcarbamoyl)-5-nitrophenylboronic acid is utilized as a key intermediate in the synthesis of pharmaceuticals. Its ability to form various chemical bonds makes it a valuable component in the development of new drugs.
Used in Pharmaceutical Development:
3-(N-Butylcarbamoyl)-5-nitrophenylboronic acid is used as a building block in the development of pharmaceuticals targeting various diseases, such as cancer, diabetes, and bacterial infections. Its potential therapeutic applications make it an important tool in the discovery of novel treatments.
Used in Agrochemicals:
In the agrochemical industry, 3-(N-Butylcarbamoyl)-5-nitrophenylboronic acid is employed as a component in the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural products.
Used in Materials Science:
3-(N-Butylcarbamoyl)-5-nitrophenylboronic acid also finds applications in materials science, where it is used to create new materials with unique properties. Its versatility in forming chemical bonds allows for the development of innovative materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-89-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871332-89:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*9)=177
177 % 10 = 7
So 871332-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H15BN2O5/c1-2-3-4-13-11(15)8-5-9(12(16)17)7-10(6-8)14(18)19/h5-7,16-17H,2-4H2,1H3,(H,13,15)
