871332-98-8

Usage

Uses

Used in Pharmaceutical Industry:
5-BROMO-2-ETHOXYPYRIDIN-3-YLBORONIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it suitable for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-BROMO-2-ETHOXYPYRIDIN-3-YLBORONIC ACID serves as a building block for the creation of novel agrochemicals. Its versatility in organic synthesis allows for the design of new compounds with improved pesticidal properties and reduced environmental impact.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
5-BROMO-2-ETHOXYPYRIDIN-3-YLBORONIC ACID is used as a reagent in Suzuki-Miyaura cross-coupling reactions, a widely employed method in the synthesis of biaryl compounds. Its participation in these reactions enables the formation of carbon-carbon bonds, facilitating the creation of complex molecular structures with potential applications in various fields.
Used in Medicinal Chemistry:
As a boronic acid derivative, 5-BROMO-2-ETHOXYPYRIDIN-3-YLBORONIC ACID is used in medicinal chemistry for the development of new drug candidates. Its ability to form stable covalent bonds with other molecules makes it an important tool in the design and synthesis of bioactive compounds with potential therapeutic effects.
Used in Drug Discovery Processes:
In drug discovery, 5-BROMO-2-ETHOXYPYRIDIN-3-YLBORONIC ACID plays a crucial role as a versatile intermediate for the synthesis of novel compounds with potential pharmaceutical applications. Its unique structural features and reactivity contribute to the identification and optimization of new drug candidates for various therapeutic areas.

InChI:InChI=1/C7H9BBrNO3/c1-2-13-7-6(8(11)12)3-5(9)4-10-7/h3-4,11-12H,2H2,1H3