871333-04-9 Usage
Uses
Used in Organic Synthesis:
4-(Ethyl(methyl)carbamoyl)phenylboronic acid is used as a reagent in Suzuki-Miyaura cross-coupling reactions for the formation of carbon-carbon bonds. This application is crucial in the synthesis of complex organic molecules and contributes to the development of new chemical entities.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 4-(ethyl(methyl)carbamoyl)phenylboronic acid is used as a building block for the creation of new drugs. Its ability to form stable complexes with biomolecules makes it a promising candidate for the development of medications targeting various diseases.
Used in Agrochemical Development:
Similarly, in the agrochemical industry, 4-(ETHYL(METHYL)CARBAMOYL)PHENYLBORONIC ACID is utilized in the synthesis of new agrochemicals, potentially leading to the development of more effective and targeted pesticides or herbicides.
Used in Antitumor Research:
4-(Ethyl(methyl)carbamoyl)phenylboronic acid is studied for its potential antitumor properties, making it a candidate for cancer treatment. Its interaction with biomolecules could provide insights into its mechanism of action against tumor cells.
Used in Anti-Inflammatory Research:
4-(ETHYL(METHYL)CARBAMOYL)PHENYLBORONIC ACID is also being investigated for its anti-inflammatory properties, which could lead to the development of new treatments for inflammatory diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 871333-04-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 871333-04:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*3)+(2*0)+(1*4)=159
159 % 10 = 9
So 871333-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c1-3-12(2)10(13)8-4-6-9(7-5-8)11(14)15/h4-7,14-15H,3H2,1-2H3
