871333-05-0 Usage
Description
3-(1H-1,2,4-TRIAZOL-3-YL-CARBAMOYL)PHENYLBORONIC ACID is a chemical compound characterized by the presence of a 1,2,4-triazole ring and a carbamoyl group attached to a phenylboronate moiety. This unique structure endows it with potential applications in various fields, particularly in pharmaceutical chemistry.
Uses
Used in Pharmaceutical Industry:
3-(1H-1,2,4-TRIAZOL-3-YL-CARBAMOYL)PHENYLBORONIC ACID is used as a pharmaceutical compound for its potential therapeutic properties. The presence of the 1,2,4-triazole ring and the carbamoyl group allows for the modulation of biological targets and interactions with cellular receptors, making it a promising candidate for the development of new drugs.
Additionally, the boronate moiety in this compound may facilitate its use in targeted drug delivery systems, where it can be selectively directed to specific tissues or cells, enhancing the efficacy and reducing the side effects of the treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 871333-05-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871333-05:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*3)+(2*0)+(1*5)=160
160 % 10 = 0
So 871333-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BN4O3/c15-8(13-9-11-5-12-14-9)6-2-1-3-7(4-6)10(16)17/h1-5,16-17H,(H2,11,12,13,14,15)