871333-98-1 Usage
Uses
Used in Pharmaceutical Industry:
2-NORBORNEN-2-YLBORONIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds, particularly in the preparation of substituted pyrazolylacetic acids. These pyrazolylacetic acids act as inhibitors of viral replication, playing a crucial role in the development of antiviral drugs.
Used in Organic Synthesis:
As a building block, 2-NORBORNEN-2-YLBORONIC ACID is utilized in the synthesis of a wide range of organic compounds, including complex molecules and pharmaceutical agents. Its unique structure and reactivity make it a valuable component in the development of new chemical entities and materials.
Used in Material Science:
2-NORBORNEN-2-YLBORONIC ACID's properties also make it suitable for use in material science, where it can be incorporated into the design and synthesis of advanced materials with specific properties, such as polymers, coatings, and composites.
Check Digit Verification of cas no
The CAS Registry Mumber 871333-98-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 871333-98:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*3)+(2*9)+(1*8)=181
181 % 10 = 1
So 871333-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H11BO2/c9-8(10)7-4-5-1-2-6(7)3-5/h4-6,9-10H,1-3H2
