87153-04-6 Usage
Description
3,4-DIHYDRO-6-[4-[1-(TRANS-4-HYDROXYCYCLOHEXYL)-1H-TETRAZOL-5-YL]BUTOXY]-2(1H)-QUINOLINONE is a complex organic compound with a unique molecular structure. It is characterized by a quinolone core, with a 3,4-dihydro and 6-hydroxy group attached. The molecule also contains a trans-4-hydroxycyclohexyl tetrazole moiety and a butoxy group, which contribute to its chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
3,4-DIHYDRO-6-[4-[1-(TRANS-4-HYDROXYCYCLOHEXYL)-1H-TETRAZOL-5-YL]BUTOXY]-2(1H)-QUINOLINONE is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure allows it to interact with biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
3,4-DIHYDRO-6-[4-[1-(TRANS-4-HYDROXYCYCLOHEXYL)-1H-TETRAZOL-5-YL]BUTOXY]-2(1H)-QUINOLINONE is also used in chemical research for its unique properties and potential applications. Researchers can study its chemical behavior and interactions with other molecules to gain insights into its potential uses and develop new applications.
Used as a Labelled Metabolite:
3,4-DIHYDRO-6-[4-[1-(TRANS-4-HYDROXYCYCLOHEXYL)-1H-TETRAZOL-5-YL]BUTOXY]-2(1H)-QUINOLINONE can be used as a labelled metabolite in various analytical techniques. Its unique structure and properties make it suitable for tracking and analyzing metabolic pathways, which can be useful in both research and clinical settings.
Chemical Properties:
3,4-DIHYDRO-6-[4-[1-(TRANS-4-HYDROXYCYCLOHEXYL)-1H-TETRAZOL-5-YL]BUTOXY]-2(1H)-QUINOLINONE is a white to off-white solid, indicating its stability and potential for use in various applications. Its solid-state properties can be further studied to understand its behavior in different environments and its interactions with other compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 87153-04-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,1,5 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 87153-04:
(7*8)+(6*7)+(5*1)+(4*5)+(3*3)+(2*0)+(1*4)=136
136 % 10 = 6
So 87153-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H27N5O3/c26-16-7-5-15(6-8-16)25-19(22-23-24-25)3-1-2-12-28-17-9-10-18-14(13-17)4-11-20(27)21-18/h9-10,13,15-16,26H,1-8,11-12H2,(H,21,27)/t15?,16-