871583-15-2 Usage
Uses
Used in Pharmaceutical Industry:
Methyl 4-Bromo-5-azaindole-2-carboxylate is used as a building block in the development of new drugs and active pharmaceutical ingredients. Its unique properties and reactivity make it a promising candidate for the synthesis of bioactive compounds and drug discovery.
Used in Organic Synthesis:
Methyl 4-Bromo-5-azaindole-2-carboxylate is used as a versatile reagent in organic synthesis due to its ability to participate in various chemical reactions. Its bromine atom and azaindole moiety contribute to its reactivity and make it a valuable component in the synthesis of complex organic molecules.
Used in Medicinal Chemistry Research:
Methyl 4-Bromo-5-azaindole-2-carboxylate is used in medicinal chemistry research to explore its potential applications in the development of new therapeutic agents. Its unique properties and reactivity make it an interesting compound for chemists and researchers working on the synthesis of bioactive compounds and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 871583-15-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,5,8 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871583-15:
(8*8)+(7*7)+(6*1)+(5*5)+(4*8)+(3*3)+(2*1)+(1*5)=192
192 % 10 = 2
So 871583-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)7-4-5-6(12-7)2-3-11-8(5)10/h2-4,12H,1H3
871583-15-2Relevant academic research and scientific papers
The Hemetsberger-Knittel synthesis of substituted 5-, 6-, and 7-azaindoles
Roy, Patrick J.,Dufresne, Claude,Lachance, Nicolas,Leclerc, Jean-Philippe,Boisvert, Michel,Wang, Zhaoyin,Leblanc, Yves
, p. 2751 - 2757 (2007/10/03)
A series of substituted 5-, 6-, and 7-azaindoles were prepared via the Hemetsberger-Knittel reaction. In general, better yields were obtained at higher temperatures and shorter reaction times than required for the formation of the analogous indoles, and in some cases, only decomposition occurred below a minimum temperature. The resulting templates offer up to five sites for subsequent functionalization to allow a wide range of chemical diversity. Georg Thieme Verlag Stuttgart.
