872047-67-1 Usage
Uses
Used in Organic Synthesis:
6-Quinoxalinemethanamine is used as a building block in organic synthesis for the creation of various biologically active compounds. Its unique chemical structure allows for the development of new molecules with potential applications in various fields.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-Quinoxalinemethanamine is utilized for the development of potential therapeutic agents. Its properties make it a promising candidate for the design and synthesis of new drugs with improved efficacy and selectivity.
Used in Pharmaceutical Industry:
6-Quinoxalinemethanamine is used as a key intermediate in the synthesis of pharmaceuticals. Its presence in the molecular structure of certain drugs contributes to their therapeutic effects, making it an essential component in the development of novel medications.
Used in Agrochemicals:
6-Quinoxalinemethanamine also finds applications in the agrochemical industry, where it is used in the development of pesticides and other agricultural chemicals. Its ability to interact with biological systems makes it a valuable component in the creation of effective and targeted agrochemicals.
Used in Materials Science:
In the field of materials science, 6-Quinoxalinemethanamine is employed for the development of new materials with unique properties. Its chemical structure allows for the creation of materials with potential applications in various industries, including electronics, energy, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 872047-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,2,0,4 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 872047-67:
(8*8)+(7*7)+(6*2)+(5*0)+(4*4)+(3*7)+(2*6)+(1*7)=181
181 % 10 = 1
So 872047-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-5H,6,10H2
