872414-52-3 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(BromoMethyl)benzamide is used as an intermediate in the synthesis of various pharmaceuticals for its ability to undergo nucleophilic substitution reactions. This property enables the creation of a wide range of organic compounds with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 2-(BromoMethyl)benzamide is utilized as a key building block for the preparation of diverse organic molecules. Its reactivity with nucleophiles allows for the formation of new chemical entities that can be further modified or functionalized for specific applications.
It is crucial to handle and store 2-(BromoMethyl)benzamide according to proper safety guidelines due to its potential health and environmental hazards, ensuring the safety of both individuals and the environment during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 872414-52-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,2,4,1 and 4 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 872414-52:
(8*8)+(7*7)+(6*2)+(5*4)+(4*1)+(3*4)+(2*5)+(1*2)=173
173 % 10 = 3
So 872414-52-3 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8BrNO/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H2,10,11)
