874219-19-9 Usage
Uses
Used in Pharmaceutical Chemistry:
4-Fluoro-3-(methylcarbamoyl)benzenboronic acid is used as a reagent in Suzuki-Miyaura cross-coupling reactions for the synthesis of various biologically active compounds. Its unique structure allows for the creation of new pharmaceuticals with potential therapeutic applications.
Used in Materials Chemistry:
In the field of materials chemistry, 4-Fluoro-3-(methylcarbamoyl)benzenboronic acid is utilized as a reagent to develop new materials with specific properties. Its involvement in cross-coupling reactions enables the production of materials with tailored characteristics for various applications.
Used in Agrochemical Development:
4-Fluoro-3-(methylcarbamoyl)benzenboronic acid is also important in the development of new agrochemicals, where its participation in cross-coupling reactions can lead to the synthesis of novel compounds with pesticidal or herbicidal properties, contributing to more effective crop protection strategies.
Overall, 4-Fluoro-3-(methylcarbamoyl)benzenboronic acid is a versatile chemical intermediate with significant implications in the synthesis and development of pharmaceuticals, materials, and agrochemicals, underpinning its utility across multiple scientific disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-19-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874219-19:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*1)+(1*9)=189
189 % 10 = 9
So 874219-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BFNO3/c1-11-8(12)6-4-5(9(13)14)2-3-7(6)10/h2-4,13-14H,1H3,(H,11,12)
