874219-41-7 Usage
General Description
3-(Benzylcarbamoyl)-5-fluorobenzenboronic acid is a chemical compound with the molecular formula C14H13BFNO3. It is a boronic acid derivative used in organic synthesis as a building block for the preparation of pharmaceuticals and other biologically active compounds. 3-(BENZYLCARBAMOYL)-5-FLUOROBENZENEBORONIC ACID contains a boronic acid group, which is widely used in Suzuki-Miyaura coupling reactions to form carbon-carbon bonds, making it a valuable tool in the synthesis of more complex organic molecules. Additionally, the presence of the fluoro and benzylcarbamoyl groups in the structure further expands its synthetic versatility, making it a valuable molecule in medicinal and materials chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-41-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 874219-41:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*4)+(1*1)=187
187 % 10 = 7
So 874219-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BFNO3/c16-13-7-11(6-12(8-13)15(19)20)14(18)17-9-10-4-2-1-3-5-10/h1-8,19-20H,9H2,(H,17,18)