874219-41-7 Usage
Uses
Used in Pharmaceutical Industry:
3-(Benzylcarbamoyl)-5-fluorobenzenboronic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its boronic acid group allows for the formation of carbon-carbon bonds through Suzuki-Miyaura coupling reactions, facilitating the creation of more complex organic molecules with potential therapeutic applications.
Used in Organic Synthesis:
3-(Benzylcarbamoyl)-5-fluorobenzenboronic acid is used as a versatile building block in organic synthesis. Its unique structure, featuring a boronic acid group, fluoro, and benzylcarbamoyl groups, enables the formation of diverse organic molecules with potential applications in various fields, including materials chemistry and drug development.
Used in Medicinal Chemistry:
3-(Benzylcarbamoyl)-5-fluorobenzenboronic acid is used as a valuable molecule in medicinal chemistry. Its synthetic versatility and ability to form carbon-carbon bonds make it a promising candidate for the development of new drugs and biologically active compounds with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-41-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 874219-41:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*4)+(1*1)=187
187 % 10 = 7
So 874219-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BFNO3/c16-13-7-11(6-12(8-13)15(19)20)14(18)17-9-10-4-2-1-3-5-10/h1-8,19-20H,9H2,(H,17,18)
