874288-01-4 Usage
Uses
Used in Organic Synthesis:
4-(2-Bromophenylcarbamoyl)phenylboronic acid is used as a reagent in organic synthesis for its ability to participate in cross-coupling reactions. This property allows for the formation of carbon-carbon and carbon-heteroatom bonds, which are crucial for constructing complex organic molecules and frameworks.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-(2-Bromophenylcarbamoyl)phenylboronic acid is used as a building block for the synthesis of biologically active compounds. Its structural features make it a promising candidate for the development of potential drug candidates, contributing to the advancement of new therapeutic agents.
Used in the Development of New Pharmaceuticals:
4-(2-Bromophenylcarbamoyl)phenylboronic acid is utilized in the development of new pharmaceuticals due to its potential to be incorporated into the molecular structures of drugs. Its unique functional groups facilitate the creation of novel compounds with specific therapeutic properties.
Used in Materials Science:
4-(2-BROMOPHENYLCARBAMOYL)PHENYLBORONIC ACID also finds application in materials science, where it may contribute to the development of new materials with specialized properties. The versatility of 4-(2-Bromophenylcarbamoyl)phenylboronic acid in forming different types of chemical bonds makes it a valuable component in material innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 874288-01:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*0)+(1*1)=204
204 % 10 = 4
So 874288-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BBrNO3/c15-11-3-1-2-4-12(11)16-13(17)9-5-7-10(8-6-9)14(18)19/h1-8,18-19H,(H,16,17)
