874288-05-8 Usage
Uses
Used in Organic Synthesis:
4-(3-Fluorophenylcarbamoyl)phenylboronic acid is used as a reagent in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its boronic acid functionality allows it to participate in various coupling reactions, making it a valuable building block for the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 4-(3-Fluorophenylcarbamoyl)phenylboronic acid is used as a potential anticancer agent. Boronic acids have been studied for their ability to inhibit enzymes and disrupt cellular processes in cancer cells, offering a promising avenue for the development of novel therapeutic agents. Additionally, 4-(3-FLUOROPHENYLCARBAMOYL)PHENYLBORONIC ACID may also have potential applications in the treatment of other diseases, given the diverse biological activities of boronic acid-containing compounds.
Used in Materials Science:
4-(3-Fluorophenylcarbamoyl)phenylboronic acid may also find applications in materials science. Its unique structure and reactivity could be harnessed to develop new materials with specific properties, such as sensors, catalysts, or functional coatings.
Used as a Building Block for Synthesis:
In the field of organic chemistry, 4-(3-Fluorophenylcarbamoyl)phenylboronic acid serves as a valuable building block for the synthesis of various organic compounds. Its ability to form stable intermediates and participate in a wide range of reactions makes it a useful component in the construction of complex molecular architectures.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-05-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 874288-05:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*0)+(1*5)=208
208 % 10 = 8
So 874288-05-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BFNO3/c15-11-2-1-3-12(8-11)16-13(17)9-4-6-10(7-5-9)14(18)19/h1-8,18-19H,(H,16,17)
