874288-10-5 Usage
Uses
Used in Organic Synthesis:
3-(3-CHLOROPROPYLCARBAMOYL)BENZENEBORONIC ACID is used as a reagent for the Suzuki-Miyaura cross-coupling reaction, a widely employed method for forming carbon-carbon bonds. This reaction is crucial for the synthesis of complex organic molecules.
Used in Pharmaceutical Development:
3-(3-CHLOROPROPYLCARBAMOYL)BENZENEBORONIC ACID is utilized in the development of pharmaceuticals due to its potential to facilitate the creation of complex organic molecules that can be used as drug candidates.
Used in Agrochemicals:
In the agrochemical industry, 3-(3-CHLOROPROPYLCARBAMOYL)BENZENEBORONIC ACID is used as a building block for the synthesis of various agrochemical compounds, contributing to the development of new pesticides and other agricultural chemicals.
Used in Materials Science:
3-(3-CHLOROPROPYLCARBAMOYL)BENZENEBORONIC ACID is also employed in materials science for the synthesis of novel materials with specific properties, such as those with enhanced thermal stability or electrical conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-10-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 874288-10:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*1)+(1*0)=205
205 % 10 = 5
So 874288-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BClNO3/c12-5-2-6-13-10(14)8-3-1-4-9(7-8)11(15)16/h1,3-4,7,15-16H,2,5-6H2,(H,13,14)
