874288-12-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3-(2-Chloroethylcarbamoyl)benzeneboronic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various drugs. Its presence in these molecules can contribute to their therapeutic effects, including anti-cancer and anti-inflammatory properties.
Used in Organic Synthesis:
In the field of organic chemistry, 3-(2-Chloroethylcarbamoyl)benzeneboronic acid is used as a versatile building block for the creation of complex organic molecules. Its reactivity and functional groups make it suitable for a wide range of chemical reactions, facilitating the development of new compounds with potential applications in various industries.
Used in Medicinal Chemistry:
3-(2-Chloroethylcarbamoyl)benzeneboronic acid is utilized as a component in the design and synthesis of biologically active molecules. Its potential to modulate biological pathways and target specific cellular processes makes it a valuable asset in the development of new therapeutic agents.
Used in Metal-Catalyzed Cross-Coupling Reactions:
As a ligand in metal-catalyzed cross-coupling reactions, 3-(2-Chloroethylcarbamoyl)benzeneboronic acid plays a crucial role in facilitating the formation of carbon-carbon bonds. This application is particularly important in the synthesis of complex organic compounds and the development of new materials with specific properties.
Used in Research and Development:
3-(2-Chloroethylcarbamoyl)benzeneboronic acid is employed in research settings to study its potential applications and to explore its chemical properties. Its use in this context aids in the advancement of knowledge in organic synthesis, medicinal chemistry, and related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-12-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 874288-12:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*1)+(1*2)=207
207 % 10 = 7
So 874288-12-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BClNO3/c11-4-5-12-9(13)7-2-1-3-8(6-7)10(14)15/h1-3,6,14-15H,4-5H2,(H,12,13)
