874288-30-9 Usage
Uses
Used in Organic Synthesis:
3-(2-Bromophenylcarbamoyl)phenylboronic acid is used as a reagent for the formation of carbon-carbon and carbon-oxygen bonds in organic synthesis. Its unique structure allows for versatile applications in the creation of various organic compounds.
Used in the Suzuki-Miyaura Cross-Coupling Reaction:
In the field of organic chemistry, 3-(2-Bromophenylcarbamoyl)phenylboronic acid is used as a key component in the Suzuki-Miyaura cross-coupling reaction. This reaction is a widely used method for the synthesis of biaryl compounds, which are important in the production of pharmaceuticals, agrochemicals, and materials with unique electronic properties.
Used in Pharmaceutical Industry:
3-(2-Bromophenylcarbamoyl)phenylboronic acid is used as an intermediate in the synthesis of pharmaceutical compounds. Its ability to form carbon-carbon and carbon-oxygen bonds makes it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 3-(2-Bromophenylcarbamoyl)phenylboronic acid is used as a precursor in the synthesis of agrochemicals. Its versatility in forming different types of chemical bonds allows for the creation of compounds with specific properties, such as herbicidal, insecticidal, or fungicidal activities.
Used in Materials Science:
3-(2-Bromophenylcarbamoyl)phenylboronic acid is used in the development of materials with unique electronic properties. The synthesis of biaryl compounds through the Suzuki-Miyaura cross-coupling reaction can lead to the creation of materials with specific electronic characteristics, such as conductivity or photovoltaic properties, which are valuable in various applications, including sensors, solar cells, and electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-30-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 874288-30:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*3)+(1*0)=209
209 % 10 = 9
So 874288-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BBrNO3/c15-11-6-1-2-7-12(11)16-13(17)9-4-3-5-10(8-9)14(18)19/h1-8,18-19H,(H,16,17)
