874288-31-0 Usage
Uses
Used in Pharmaceutical Industry:
3-[(4-Chlorophenyl)carbamoyl]benzeneboronic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its reactivity and stability make it a valuable component in the development of new drugs and medicinal agents.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-[(4-Chlorophenyl)carbamoyl]benzeneboronic acid is used as a reagent in Suzuki reactions, which are cross-coupling reactions that facilitate the formation of carbon-carbon bonds. This application is crucial for the creation of complex organic molecules and contributes to the advancement of organic chemistry.
Used in Research and Development:
3-[(4-Chlorophenyl)carbamoyl]benzeneboronic acid is utilized in research and development settings to explore its potential applications and properties. Its unique structure and reactivity make it an interesting subject for scientific studies, which could lead to new discoveries and innovations in various chemical and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-31-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 874288-31:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*3)+(1*1)=210
210 % 10 = 0
So 874288-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BClNO3/c15-11-4-6-12(7-5-11)16-13(17)9-2-1-3-10(8-9)14(18)19/h1-8,18-19H,(H,16,17)
