874288-34-3 Usage
Uses
Used in Organic Synthesis:
3-(3-Fluorophenylcarbamoyl)phenylboronic acid is used as a reagent in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique structure allows for versatile reactions, contributing to the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(3-Fluorophenylcarbamoyl)phenylboronic acid is used as a key intermediate in the development of new drugs. Its potential applications in medicinal chemistry are being explored for the creation of compounds that can target specific medical conditions, thereby enhancing treatment options.
Used in Suzuki-Miyaura Coupling Reactions:
3-(3-Fluorophenylcarbamoyl)phenylboronic acid is utilized as a valuable tool in Suzuki-Miyaura coupling reactions, which are crucial for the construction of biaryl compounds. These reactions are fundamental in the synthesis of pharmaceuticals, agrochemicals, and materials with unique properties, making this boronic acid derivative an essential component in these processes.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 874288-34:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*3)+(1*4)=213
213 % 10 = 3
So 874288-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BFNO3/c15-11-5-2-6-12(8-11)16-13(17)9-3-1-4-10(7-9)14(18)19/h1-8,18-19H,(H,16,17)
