874288-38-7 Usage
Uses
Used in Combinatorial Chemistry:
4-Ethoxycarbonyl-3-fluorophenylboronic Acid is used as a reagent in combinatorial chemistry for the synthesis of analog libraries of compounds. This includes the creation of diverse chemical structures such as isoquinolines, furan, and benzo[b]thiophenes. The versatility of this boronic acid allows for the exploration of new chemical space and the development of novel compounds with potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 874288-38-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 874288-38:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*8)+(2*3)+(1*8)=217
217 % 10 = 7
So 874288-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BFO4/c1-2-15-9(12)7-4-3-6(10(13)14)5-8(7)11/h3-5,13-14H,2H2,1H3
