874289-09-5 Usage
Uses
Used in Chemical Research:
3-Fluoro-4-(pyrrolidine-1-carbonyl)phenylboronic Acid is used as a reagent for cross-coupling reactions in chemical research. It facilitates the formation of carbon-carbon and carbon-heteroatom bonds, which are essential in the synthesis of complex organic molecules and pharmaceutical compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Fluoro-4-(pyrrolidine-1-carbonyl)phenylboronic Acid is used as a key intermediate in the synthesis of various drug molecules. Its ability to participate in cross-coupling reactions allows for the creation of novel compounds with potential therapeutic applications.
Used in Material Science:
3-Fluoro-4-(pyrrolidine-1-carbonyl)phenylboronic Acid is also employed in material science as a precursor for the development of new materials with unique properties. Its involvement in cross-coupling reactions can lead to the formation of advanced polymers, coatings, and other materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 874289-09-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874289-09:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*9)+(2*0)+(1*9)=215
215 % 10 = 5
So 874289-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BFNO3/c13-10-7-8(12(16)17)3-4-9(10)11(15)14-5-1-2-6-14/h3-4,7,16-17H,1-2,5-6H2
