874289-58-4 Usage
General Description
2-FLUORO-5-(METHOXYCARBAMOYL)BENZENEBORONIC ACID is a chemical compound that has both fluorine and boronic acid functional groups. It is commonly used in organic synthesis as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds. 2-FLUORO-5-(METHOXYCARBAMOYL)BENZENEBORONIC ACID is often utilized in the production of pharmaceuticals, agrochemicals, and materials science. Its boronic acid group has the ability to form stable complexes with other molecules, making it a valuable tool for creating various chemical structures. Additionally, the presence of the fluorine group can provide specific properties such as increased lipophilicity and bioavailability in drug design.
Check Digit Verification of cas no
The CAS Registry Mumber 874289-58-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 874289-58:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*9)+(2*5)+(1*8)=224
224 % 10 = 4
So 874289-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BFNO4/c1-15-11-8(12)5-2-3-7(10)6(4-5)9(13)14/h2-4,13-14H,1H3,(H,11,12)