874290-69-4 Usage
Uses
Used in Organic Synthesis:
4-FLUORO-3-(METHOXY(METHYL)CARBAMOYL)PHENYLBORONIC ACID is utilized as a key building block in organic synthesis for the assembly of complex organic molecules. Its unique structure allows for the formation of new chemical entities with potential applications in various fields.
Used in Medicinal Chemistry:
In the domain of medicinal chemistry, 4-FLUORO-3-(METHOXY(METHYL)CARBAMOYL)PHENYLBORONIC ACID serves as a crucial component in the design and synthesis of pharmaceuticals. Its incorporation into drug molecules can enhance their biological activity and selectivity, contributing to the development of more effective therapeutic agents.
Used in the Development of New Materials:
4-FLUORO-3-(METHOXY(METHYL)CARBAMOYL)PHENYLBORONIC ACID is also employed in material science for the development of novel materials. Its chemical properties can be harnessed to create materials with specific characteristics, such as improved stability or reactivity, which can be beneficial in various industrial applications.
Used as a Reagent in Chemical Reactions:
Furthermore, 4-FLUORO-3-(METHOXY(METHYL)CARBAMOYL)PHENYLBORONIC ACID functions as a reagent in a range of chemical reactions. Its ability to participate in diverse chemical processes makes it a valuable tool for researchers and chemists in advancing the synthesis of new compounds and improving existing synthetic routes.
Overall, 4-FLUORO-3-(METHOXY(METHYL)CARBAMOYL)PHENYLBORONIC ACID's applications span across multiple industries, highlighting its significance in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 874290-69-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,9 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874290-69:
(8*8)+(7*7)+(6*4)+(5*2)+(4*9)+(3*0)+(2*6)+(1*9)=204
204 % 10 = 4
So 874290-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BFNO4/c1-12(16-2)9(13)7-5-6(10(14)15)3-4-8(7)11/h3-5,14-15H,1-2H3