874459-62-8 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Fluoro-4-ethoxycarbonylphenylboronic acid is used as a key building block in the synthesis of pharmaceuticals for its ability to be incorporated into complex organic molecules through Suzuki-Miyaura cross-coupling reactions. This allows for the development of new drugs with improved pharmacological properties and therapeutic potential.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2-fluoro-4-ethoxycarbonylphenylboronic acid is utilized as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its unique structure and reactivity enable the creation of novel compounds with enhanced efficacy and selectivity in controlling pests and weeds.
Used in Drug Discovery and Development:
The presence of a fluorine atom in 2-fluoro-4-ethoxycarbonylphenylboronic acid provides unique properties that can be advantageous in drug discovery and development. The fluorine atom can influence the lipophilicity, metabolic stability, and binding affinity of the resulting compounds, leading to improved drug candidates with better pharmacokinetic and pharmacodynamic profiles.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
2-Fluoro-4-ethoxycarbonylphenylboronic acid is used as a reagent in Suzuki-Miyaura cross-coupling reactions for the introduction of phenylboronic acid moieties into various organic molecules. This reaction is widely employed in the synthesis of complex organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals, due to its mild reaction conditions and broad substrate scope.
Overall, 2-fluoro-4-ethoxycarbonylphenylboronic acid is a versatile and valuable chemical with potential applications in various fields of research and industry, including pharmaceutical and agrochemical synthesis, drug discovery, and development, as well as in key organic synthesis reactions such as the Suzuki-Miyaura cross-coupling.
Check Digit Verification of cas no
The CAS Registry Mumber 874459-62-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,4,5 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 874459-62:
(8*8)+(7*7)+(6*4)+(5*4)+(4*5)+(3*9)+(2*6)+(1*2)=218
218 % 10 = 8
So 874459-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BFO4/c1-2-15-9(12)6-3-4-7(10(13)14)8(11)5-6/h3-5,13-14H,2H2,1H3
