874459-62-8 Usage
General Description
2-Fluoro-4-ethoxycarbonylphenylboronic acid is a derivative of phenylboronic acid with a fluorine atom and an ethoxycarbonyl group attached to the phenyl ring. It is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. Its boronic acid functionality makes it a useful reagent for Suzuki-Miyaura cross-coupling reactions, allowing for the introduction of the phenylboronic acid moiety into various organic molecules. Additionally, its fluorine atom provides unique properties that can be useful in drug discovery and development. Overall, 2-fluoro-4-ethoxycarbonylphenylboronic acid is a versatile chemical with potential applications in various fields of research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 874459-62-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,4,5 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 874459-62:
(8*8)+(7*7)+(6*4)+(5*4)+(4*5)+(3*9)+(2*6)+(1*2)=218
218 % 10 = 8
So 874459-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BFO4/c1-2-15-9(12)6-3-4-7(10(13)14)8(11)5-6/h3-5,13-14H,2H2,1H3