874459-76-4 Usage
Uses
Used in Chemical Research and Synthesis:
(3-Isobutramido)benzeneboronic acid is used as a key reagent in chemical research and synthesis for its ability to form stable and reversible complexes with diols, amines, and other organic molecules, which aids in the development of new chemical entities and synthetic methodologies.
Used in the Suzuki Reaction:
In the field of organic chemistry, (3-Isobutramido)benzeneboronic acid is utilized as a crucial component in the Suzuki reaction, a widely recognized coupling reaction for the formation of carbon-carbon bonds. Its application in this reaction is instrumental in the synthesis of complex organic molecules with high efficiency and selectivity.
Used in Drug Discovery:
(3-Isobutramido)benzeneboronic acid is employed in drug discovery for its unique properties that allow it to interact with various organic molecules, making it a valuable tool in the identification and development of new pharmaceutical compounds.
Used in Material Science:
In material science, (3-Isobutramido)benzeneboronic acid is used for its potential to form complexes with different organic and inorganic materials, contributing to the advancement of material properties and the creation of novel materials with specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 874459-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,4,5 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 874459-76:
(8*8)+(7*7)+(6*4)+(5*4)+(4*5)+(3*9)+(2*7)+(1*6)=224
224 % 10 = 4
So 874459-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c1-7(2)10(13)12-9-5-3-4-8(6-9)11(14)15/h3-7,14-15H,1-2H3,(H,12,13)
