875664-41-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-4,5-difluoroaniline is used as a key intermediate in the synthesis of various biologically active compounds, contributing to the development of new drugs with therapeutic potential. Its unique structural features allow for the creation of novel pharmaceutical agents that can target specific biological pathways or receptors, leading to improved treatment options for various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-4,5-difluoroaniline is utilized as a precursor in the production of pesticides and other crop protection agents. Its reactivity and ability to form stable derivatives make it a valuable component in the development of effective and environmentally friendly agrochemicals that can protect crops from pests and diseases while minimizing harm to the ecosystem.
Used in Research Laboratories:
3-Bromo-4,5-difluoroaniline is commonly found in research settings where organic synthesis and the study of novel chemical compounds are conducted. Its unique properties and reactivity make it an attractive candidate for exploration in various research projects, including the development of new synthetic methods, the investigation of its reactivity with other molecules, and the study of its potential applications in various fields.
Used in Industrial Settings:
In industrial applications, 3-Bromo-4,5-difluoroaniline plays a vital role in the large-scale production of pharmaceuticals and agrochemicals. Its use as an intermediate in the synthesis of various compounds allows for the efficient and cost-effective manufacturing of these products, ensuring their availability for use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 875664-41-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,5,6,6 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 875664-41:
(8*8)+(7*7)+(6*5)+(5*6)+(4*6)+(3*4)+(2*4)+(1*1)=218
218 % 10 = 8
So 875664-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrF2N/c7-4-1-3(10)2-5(8)6(4)9/h1-2H,10H2
