876-33-5 Usage
Description
1-[(AMMONIOOXY)METHYL]-4-METHOXYBENZENE CHLORIDE, also known as O-(4-Methoxybenzyl)hydroxylamine hydrochloride, is an organic compound with a chemical structure that features a chlorinated benzene ring, a methoxy group, and an aminoxy-methyl group. 1-[(AMMONIOOXY)METHYL]-4-METHOXYBENZENE CHLORIDE is characterized by its reactivity and functional groups, which make it a versatile intermediate in various chemical processes.
Uses
Used in Pharmaceutical Industry:
1-[(AMMONIOOXY)METHYL]-4-METHOXYBENZENE CHLORIDE is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In the field of chemical research, 1-[(AMMONIOOXY)METHYL]-4-METHOXYBENZENE CHLORIDE serves as a valuable intermediate for the exploration of new chemical reactions and the synthesis of novel organic compounds. Its reactivity and functional groups make it an ideal candidate for studying reaction mechanisms and developing new synthetic methodologies.
Used in Chemical Analysis:
1-[(AMMONIOOXY)METHYL]-4-METHOXYBENZENE CHLORIDE is also utilized in chemical analysis for the identification and characterization of related compounds. Its distinct chemical properties can be employed as a reference or standard in analytical techniques such as chromatography, mass spectrometry, and nuclear magnetic resonance (NMR) spectroscopy.
Check Digit Verification of cas no
The CAS Registry Mumber 876-33-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 876-33:
(5*8)+(4*7)+(3*6)+(2*3)+(1*3)=95
95 % 10 = 5
So 876-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2.ClH/c1-10-8-4-2-7(3-5-8)6-11-9;/h2-5H,6,9H2,1H3;1H
