87617-01-4 Usage
Chemical class
Azo compound
Explanation
Different sources of media describe the Explanation of 87617-01-4 differently. You can refer to the following data:
1. The compound contains an azo group (-N=N-), which is a common feature in dyes and pigments.
2. The compound has multiple functional groups, which contribute to its chemical properties and potential applications.
3. The presence of a chlorine atom in the 4-position of the nitrophenyl group may affect the compound's reactivity and stability.
4. The nitro group (-NO2) can provide antibacterial properties and may also influence the compound's color.
5. The hydroxyl group (-OH) can participate in hydrogen bonding and may affect the compound's solubility and reactivity.
6. The methyl group (-CH3) can influence the compound's steric properties and may affect its reactivity.
7. The cyano group (-CN) is a common feature in various industrial chemicals and can contribute to the compound's reactivity.
8. Due to the presence of the azo group, the compound is likely used in the production of dyes and pigments.
9. The presence of the nitro group suggests that the compound may have some antibacterial properties, which could be useful in various applications.
10. The compound's specific name reflects its precise molecular structure and composition, making it a unique and potentially valuable substance in various chemical processes.
Functional groups
Butyl group, nitrophenyl group, dihydro-6-hydroxy-4-methyl-2-oxonicotinonitrile group
Presence of chlorine
4-chloro substituent
Presence of a nitro group
2-nitro substituent
Hydroxyl group
6-hydroxy substituent
Methyl group
4-methyl substituent
Cyano group
2-oxo-nicotinonitrile group
Industrial applications
Dyes and pigments
Potential antibacterial properties
Nitro group
Unique molecular structure
Specific name
Check Digit Verification of cas no
The CAS Registry Mumber 87617-01-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,6,1 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 87617-01:
(7*8)+(6*7)+(5*6)+(4*1)+(3*7)+(2*0)+(1*1)=154
154 % 10 = 4
So 87617-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16ClN5O4/c1-3-4-7-22-16(24)12(9-19)10(2)15(17(22)25)21-20-13-6-5-11(18)8-14(13)23(26)27/h5-6,8,20H,3-4,7H2,1-2H3/b21-15+