876379-80-5 Usage
Uses
Used in Medicinal Chemistry:
3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid is utilized as a key intermediate in the synthesis of pharmaceuticals for targeting specific enzymes or receptors. Its unique structure allows for the development of drugs with high specificity and potency, making it a promising candidate for the treatment of various diseases.
Used in Drug Development:
In the pharmaceutical industry, 3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid serves as a starting material for the creation of novel bioactive molecules. Its properties enable the design of drugs with improved efficacy, selectivity, and reduced side effects, contributing to the advancement of therapeutic options for patients.
Used in Chemical Research:
3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid is employed as a subject of study in chemical research to better understand its properties, reactivity, and potential applications. This research aids in the discovery of new synthetic routes, reaction mechanisms, and the development of innovative applications in various chemical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 876379-80-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,3,7 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 876379-80:
(8*8)+(7*7)+(6*6)+(5*3)+(4*7)+(3*9)+(2*8)+(1*0)=235
235 % 10 = 5
So 876379-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClN2O2/c9-6-4-10-11-2-1-5(8(12)13)3-7(6)11/h1-4H,(H,12,13)
876379-80-5Relevant academic research and scientific papers
INDOLIZINE CARBOXAMIDES AND THE AZA AND DIAZA DERIVATIVES THEREOF
-
Page/Page column 49, (2010/10/19)
The invention relates to neuroreceptor-active carboxamide-substituted indolizine derivatives of general formula (I) wherein X represents a group of general formula (X1).
