87656-32-4 Usage
General Description
2-(diMethoxyMethyl)phenylMethanol, also known as 2-(diMethoxyMethyl)benzyl alcohol, is a chemical compound with the molecular formula C10H14O3. It is a colorless liquid with a mildly sweet and floral odor. This chemical is often used in the synthesis of various pharmaceuticals and organic compounds. It is also used as a fragrance ingredient in perfumes and cosmetics. Additionally, 2-(diMethoxyMethyl)phenylMethanol has potential applications in the development of new materials and polymers due to its unique chemical structure. Overall, 2-(diMethoxyMethyl)phenylMethanol has diverse industrial uses and is an essential building block in organic chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 87656-32-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,6,5 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 87656-32:
(7*8)+(6*7)+(5*6)+(4*5)+(3*6)+(2*3)+(1*2)=174
174 % 10 = 4
So 87656-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14O3/c1-12-10(13-2)9-6-4-3-5-8(9)7-11/h3-6,10-11H,7H2,1-2H3
