876715-59-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Hydroxy-6-isobutylpyrimidine-4-carboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals for its potential therapeutic applications. Its unique structure allows for the development of new compounds with targeted effects on specific biological pathways, contributing to the discovery of innovative treatments for various diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Hydroxy-6-isobutylpyrimidine-4-carboxylic acid is utilized as a building block for the production of pesticides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and diseases, thereby improving crop yields and ensuring food security.
Used as a Research Chemical:
2-Hydroxy-6-isobutylpyrimidine-4-carboxylic acid also serves as a valuable research chemical, enabling scientists to explore its potential applications in the development of new compounds with therapeutic or agricultural benefits. Its unique properties and reactivity make it an essential tool in the advancement of scientific knowledge and the creation of novel products.
Check Digit Verification of cas no
The CAS Registry Mumber 876715-59-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,7,1 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 876715-59:
(8*8)+(7*7)+(6*6)+(5*7)+(4*1)+(3*5)+(2*5)+(1*9)=222
222 % 10 = 2
So 876715-59-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O3/c1-5(2)3-6-4-7(8(12)13)11-9(14)10-6/h4-5H,3H2,1-2H3,(H,12,13)(H,10,11,14)
