876716-43-7 Usage
Uses
Used in Pharmaceutical Industry:
1-Cyclopropyl-5-oxopyrrolidine-3-carboxylic acid is used as a building block for the synthesis of various drugs due to its unique structural features that facilitate the development of new medicinal compounds.
Used in Peptide Synthesis:
In the field of peptide synthesis, 1-Cyclopropyl-5-oxopyrrolidine-3-carboxylic acid is used as a proline analogue, which is essential for the construction of specific peptide sequences that may have therapeutic applications.
Used in Protease Inhibitor Development:
As a proline mimic, 1-Cyclopropyl-5-oxopyrrolidine-3-carboxylic acid is utilized in the development of protease inhibitors, which are vital for treating various diseases by regulating enzymatic activity.
Used in Material Science:
1-CYCLOPROPYL-5-OXOPYRROLIDINE-3-CARBOXYLIC ACID's cyclopropane ring provides it with unique chemical and physical properties, making it a valuable component in the research and development of new materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 876716-43-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,7,1 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 876716-43:
(8*8)+(7*7)+(6*6)+(5*7)+(4*1)+(3*6)+(2*4)+(1*3)=217
217 % 10 = 7
So 876716-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3/c10-7-3-5(8(11)12)4-9(7)6-1-2-6/h5-6H,1-4H2,(H,11,12)
