87679-38-7 Usage
Uses
Used in Pharmaceutical Applications:
Benzyl (2S,3aR,7aS)-octahydroindole-2-carboxylate hydrochloride is used as a building block in the synthesis of various bioactive compounds and pharmaceuticals. Its water solubility and structural features make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Chemistry as a Reagent:
In the field of organic chemistry, Benzyl (2S,3aR,7aS)-octahydroindole-2-carboxylate hydrochloride serves as a reagent for various chemical reactions. Its unique structure allows for the formation of new compounds and the modification of existing ones, contributing to the advancement of chemical research and the discovery of novel chemical entities.
Used in Chemical Synthesis:
Benzyl (2S,3aR,7aS)-octahydroindole-2-carboxylate hydrochloride is used as a key intermediate in the synthesis of complex molecules. Its presence in the molecular structure facilitates the formation of new bonds and the creation of diverse chemical entities, making it an essential component in the development of innovative materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 87679-38-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,6,7 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 87679-38:
(7*8)+(6*7)+(5*6)+(4*7)+(3*9)+(2*3)+(1*8)=197
197 % 10 = 7
So 87679-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO2/c18-16(19-11-12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)17-15/h1-3,6-7,13-15,17H,4-5,8-11H2/t13-,14+,15+/m1/s1
