877-28-1 Usage
General Description
3-MERCAPTO-6-METHYL-[1,2,4]TRIAZOLO[4,3-B][1,2,4]TRIAZIN-7-OL is a chemical compound with the molecular formula C6H6N6OS and a molecular weight of 206.22 g/mol. It is a triazolo-triazinone derivative and is also known as N-(6-methyl-3-thiazolo[4,3-b][1,2,4]triazol-3-ium-7-yl)acetamide. 3-MERCAPTO-6-METHYL-[1,2,4]TRIAZOLO[4,3-B][1,2,4]TRIAZIN-7-OL has potential pharmaceutical and biological applications due to its unique structure and properties. It is used in research and development of drugs targeting various diseases and disorders. Additionally, it has potential use in agricultural and industrial applications. Further study and understanding of the properties and potential uses of this compound are warranted.
Check Digit Verification of cas no
The CAS Registry Mumber 877-28-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 877-28:
(5*8)+(4*7)+(3*7)+(2*2)+(1*8)=101
101 % 10 = 1
So 877-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5OS/c1-2-3(11)6-4-7-8-5(12)10(4)9-2/h1H3,(H,8,12)(H,6,7,11)