877161-74-5 Usage
Uses
Used in Chemical Research:
2-BROMO-3,5-DIFLUORONITROBENZENE is used as a research intermediate for the synthesis of complex organic molecules, leveraging its reactivity and unique chemical structure to facilitate various chemical reactions.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, 2-BROMO-3,5-DIFLUORONITROBENZENE serves as a key intermediate in the production of various pharmaceutical compounds. Its presence of bromine atoms makes it particularly valuable for facilitating coupling reactions, which are essential in the synthesis of certain drugs.
Safety Considerations:
Due to the reactive nature of 2-BROMO-3,5-DIFLUORONITROBENZENE, it is crucial to implement safety measures when handling this chemical to prevent potential hazards and ensure the safety of personnel and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 877161-74-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,7,1,6 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 877161-74:
(8*8)+(7*7)+(6*7)+(5*1)+(4*6)+(3*1)+(2*7)+(1*4)=205
205 % 10 = 5
So 877161-74-5 is a valid CAS Registry Number.
InChI:InChI=1S/C6H2BrF2NO2/c7-6-4(9)1-3(8)2-5(6)10(11)12/h1-2H
