878285-12-2 Usage
Uses
Used in Organic Synthesis:
2,3-Difluoro-4-chloroaniline is used as a building block in organic synthesis for the production of various chemical compounds. Its unique structure, featuring fluorine and chlorine atoms, allows for the creation of a wide range of molecules with diverse properties and applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,3-Difluoro-4-chloroaniline is employed as a key intermediate in the synthesis of pharmaceuticals. Its presence in the molecular structure can influence the pharmacological properties of the resulting compounds, making it a valuable component in drug development.
Used in Agrochemicals:
2,3-Difluoro-4-chloroaniline is also utilized in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, contributing to improved agricultural productivity.
Used in Dyes and Pigments Synthesis:
This chemical compound has potential applications in the synthesis of dyes and pigments, where its unique structure can contribute to the color and stability of the resulting products. Its use in this industry can lead to the development of new and improved colorants for various applications, including textiles, plastics, and inks.
Safety Precautions:
Due to its toxic nature and potential to cause skin and eye irritation, it is essential to handle 2,3-Difluoro-4-chloroaniline with care. Proper protective equipment, such as gloves, goggles, and respirators, should be worn when working with 2,3-Difluoro-4-chloroaniline. Additionally, it is crucial to follow safety guidelines and regulations to minimize the risk of exposure and ensure the well-being of individuals involved in its production and use.
Check Digit Verification of cas no
The CAS Registry Mumber 878285-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,8,2,8 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 878285-12:
(8*8)+(7*7)+(6*8)+(5*2)+(4*8)+(3*5)+(2*1)+(1*2)=222
222 % 10 = 2
So 878285-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClF2N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2
878285-12-2Relevant academic research and scientific papers
SUBSTITUTED AMINOPURINE COMPOUNDS, COMPOSITIONS THEREOF, AND METHODS OF TREATMENT THEREWITH
-
Paragraph 0265, (2016/05/02)
Provided herein are Aminopurine Compounds having the following structures: wherein R1, R2, and R3 are as defined herein, compositions comprising an effective amount of an Aminopurine Compound, and methods for treating or preventing a cancer, for example, melanoma.
