87865-18-7 Usage
General Description
Hydroxytrimethoxy-2H-pyrano[2,3,4-kl]xanthen-2-one is a chemical compound with a complex molecular structure. It is a xanthene derivative, which is a class of organic compounds that are often used as dyes and fluorescent labels. The presence of hydroxy and methoxy functional groups in the molecule suggests that it may have properties related to solubility, reactivity, and biological activity. Due to its unique structure, it likely has potential applications in various fields including chemistry, biochemistry, and materials science. Further research and evaluation of this compound are needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 87865-18-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,8,6 and 5 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 87865-18:
(7*8)+(6*7)+(5*8)+(4*6)+(3*5)+(2*1)+(1*8)=187
187 % 10 = 7
So 87865-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O7/c1-21-15-13-11-10(8-6-4-5-7-9(8)24-13)12(19)18(20)25-14(11)16(22-2)17(15)23-3/h4-7,19H,1-3H3