879072-59-0 Usage
Uses
Used in Pharmaceutical Development:
Pyrazolo[1,5-a]pyrimidine-3-carbaldehyde is used as a chemical intermediate for the synthesis of more complex compounds, which can be further utilized in the development of pharmaceuticals. Its unique structure allows for the creation of a wide range of molecules with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic chemistry, Pyrazolo[1,5-a]pyrimidine-3-carbaldehyde is used as a building block for the synthesis of various organic compounds. Its heterocyclic structure provides a versatile platform for the formation of new chemical entities with potential applications in different industries, such as materials science and agrochemicals.
Used in Research and Development:
Pyrazolo[1,5-a]pyrimidine-3-carbaldehyde is also used as a research compound in academic and industrial laboratories. Its synthesis and properties are studied to gain insights into the reactivity and behavior of heterocyclic compounds, which can lead to the discovery of new reactions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 879072-59-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,0,7 and 2 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 879072-59:
(8*8)+(7*7)+(6*9)+(5*0)+(4*7)+(3*2)+(2*5)+(1*9)=220
220 % 10 = 0
So 879072-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O/c11-5-6-4-9-10-3-1-2-8-7(6)10/h1-5H
