879566-77-5 Usage
Description
3-(CHLOROMETHYL)-1-METHYLQUINOLIN-2(1H)-ONE is a quinolone derivative with a molecular formula of C11H10ClNO. It features a chloromethyl group attached to the third carbon atom and a methyl group attached to the first carbon atom of the quinoline ring. This chemical compound possesses potential biological activity and is utilized in medicinal chemistry for the synthesis of innovative drug candidates. Additionally, it may have applications in the development of pesticides and other agricultural chemicals, with its specific properties and uses varying based on its molecular structure and purity.
Uses
Used in Medicinal Chemistry:
3-(CHLOROMETHYL)-1-METHYLQUINOLIN-2(1H)-ONE is used as a key intermediate in the synthesis of novel drug candidates due to its potential biological activity. Its unique structure allows for the development of new compounds with therapeutic properties, contributing to advancements in the pharmaceutical industry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(CHLOROMETHYL)-1-METHYLQUINOLIN-2(1H)-ONE is used as a building block for the creation of new medications. Its quinolone structure provides a foundation for the design of drugs targeting various diseases and conditions, offering potential treatments and improving patient outcomes.
Used in Agricultural Chemistry:
3-(CHLOROMETHYL)-1-METHYLQUINOLIN-2(1H)-ONE may also be utilized in the development of pesticides and other agricultural chemicals. Its chemical properties can be harnessed to create effective solutions for crop protection and enhancement of agricultural productivity, contributing to sustainable farming practices.
Used in Chemical Research:
In the field of chemical research, 3-(CHLOROMETHYL)-1-METHYLQUINOLIN-2(1H)-ONE serves as a subject of study for understanding its properties, reactivity, and potential applications. Researchers can explore its behavior in various chemical reactions and interactions, leading to the discovery of new compounds and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 879566-77-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,5,6 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 879566-77:
(8*8)+(7*7)+(6*9)+(5*5)+(4*6)+(3*6)+(2*7)+(1*7)=255
255 % 10 = 5
So 879566-77-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClNO/c1-13-10-5-3-2-4-8(10)6-9(7-12)11(13)14/h2-6H,7H2,1H3
