879896-44-3 Usage
General Description
The chemical compound (2,4-DIPHENYL-1,3-THIAZOL-5-YL)METHYLAMINE HYDROCHLORIDE is an organic compound with medical and industrial applications. It is a thiazole derivative with a phenyl group and a methylamine functional group. (2,4-DIPHENYL-1,3-THIAZOL-5-YL)METHYLAMINE HYDROCHLORIDE is often used in the synthesis of pharmaceuticals and agrochemicals due to its potential as a building block for various bioactive molecules. Additionally, it may also have biological activity as a potential drug target or pharmacological agent. However, further research is needed to understand its full range of applications and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 879896-44-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,8,9 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 879896-44:
(8*8)+(7*7)+(6*9)+(5*8)+(4*9)+(3*6)+(2*4)+(1*4)=273
273 % 10 = 3
So 879896-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2S.ClH/c17-11-14-15(12-7-3-1-4-8-12)18-16(19-14)13-9-5-2-6-10-13;/h1-10H,11,17H2;1H