879896-48-7 Usage
General Description
1-Methyl-3-thien-2-yl-1H-pyrazole-5-carbaldehyde is a chemical compound with the formula C10H10N2OS. It is a yellow liquid with a molecular weight of 202.27 g/mol. 1-METHYL-3-THIEN-2-YL-1H-PYRAZOLE-5-CARBALDEHYDE is a heterocyclic aromatic aldehyde, which means it contains a ring structure made up of different types of atoms, including nitrogen, sulfur, and oxygen. It has potential applications in the pharmaceutical and agrochemical industries as a building block for the synthesis of various biologically active compounds. The presence of the thiophene and pyrazole rings in its structure gives the compound unique properties and chemical reactivity, making it of interest for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 879896-48-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,8,9 and 6 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 879896-48:
(8*8)+(7*7)+(6*9)+(5*8)+(4*9)+(3*6)+(2*4)+(1*8)=277
277 % 10 = 7
So 879896-48-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2OS/c1-11-7(6-12)5-8(10-11)9-3-2-4-13-9/h2-6H,1H3