879896-52-3 Usage
General Description
(3,5-DIMETHYL-1-PHENYL-1H-PYRAZOL-4-YL)METHYLAMINE HYDROCHLORIDE, also known as Dimetridazole, is a chemical compound commonly used as an antiprotozoal medication in veterinary medicine. It is a member of the nitroheterocyclic compounds and is known for its antimicrobial properties against parasites such as Giardia, Tritrichomonas, and Histomonas. Dimetridazole works by inhibiting the growth and reproduction of these parasites, making it an effective treatment for various infections in animals. However, its use in food-producing animals has been restricted in some countries due to concerns about potential toxic effects on humans. Overall, Dimetridazole is a valuable tool in veterinary medicine for combating parasitic infections in animals.
Check Digit Verification of cas no
The CAS Registry Mumber 879896-52-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,8,9 and 6 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 879896-52:
(8*8)+(7*7)+(6*9)+(5*8)+(4*9)+(3*6)+(2*5)+(1*2)=273
273 % 10 = 3
So 879896-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3/c1-9-12(8-13)10(2)15(14-9)11-6-4-3-5-7-11/h3-7H,8,13H2,1-2H3