879896-58-9 Usage
General Description
N-Methyl-N-[(2-piperidin-1-ylpyridin-4-yl)methyl]amine is a chemical compound with the molecular formula C14H21N3. It is a tertiary amine with a piperidine and pyridine moiety attached to a methyl group. N-METHYL-N-[(2-PIPERIDIN-1-YLPYRIDIN-4-YL)METHYL]AMINE is commonly used as a building block in organic synthesis to create various pharmaceuticals and agrochemicals. It also has potential applications in the development of novel drug molecules targeting specific biological pathways. Additionally, N-Methyl-N-[(2-piperidin-1-ylpyridin-4-yl)methyl]amine is utilized in research and development as a reagent and catalyst in chemical reactions and in the production of diverse organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 879896-58-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,8,9 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 879896-58:
(8*8)+(7*7)+(6*9)+(5*8)+(4*9)+(3*6)+(2*5)+(1*8)=279
279 % 10 = 9
So 879896-58-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H19N3/c1-13-10-11-5-6-14-12(9-11)15-7-3-2-4-8-15/h5-6,9,13H,2-4,7-8,10H2,1H3
